| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:56:03 UTC |
|---|
| Update Date | 2025-03-25 00:52:12 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02192229 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C18H38NO+ |
|---|
| Molecular Mass | 284.2948 |
|---|
| SMILES | CCCCCCCC=CCCCCC(O)C[N+](C)(C)C |
|---|
| InChI Key | BVSHVOCOPCQQTN-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic nitrogen compounds |
|---|
| Class | organonitrogen compounds |
|---|
| Subclass | quaternary ammonium salts |
|---|
| Direct Parent | cholines |
|---|
| Geometric Descriptor | aliphatic acyclic compounds |
|---|
| Alternative Parents | 1,2-aminoalcoholsamineshydrocarbon derivativesorganic cationsorganic saltsorganopnictogen compoundssecondary alcoholstetraalkylammonium salts |
|---|
| Substituents | alcoholaliphatic acyclic compoundtetraalkylammonium salt1,2-aminoalcoholorganic oxygen compoundcholinesecondary alcoholorganopnictogen compoundhydrocarbon derivativeorganic cationorganic saltamineorganooxygen compound |
|---|