| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:56:05 UTC |
|---|
| Update Date | 2025-03-25 00:52:13 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02192310 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C23H39NO2 |
|---|
| Molecular Mass | 361.2981 |
|---|
| SMILES | CCCCCC=CCC=CCCCCCCC=CC=CC(=O)NCCO |
|---|
| InChI Key | RIDHDWXOBOMGEO-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic nitrogen compounds |
|---|
| Class | organonitrogen compounds |
|---|
| Subclass | amines |
|---|
| Direct Parent | n-acylethanolamines |
|---|
| Geometric Descriptor | aliphatic acyclic compounds |
|---|
| Alternative Parents | alcohols and polyolsalkanolaminescarbonyl compoundscarboxylic acids and derivativeshydrocarbon derivativesn-acyl aminesorganic oxidesorganonitrogen compoundsorganopnictogen compoundssecondary carboxylic acid amides |
|---|
| Substituents | alcoholaliphatic acyclic compoundcarbonyl groupcarboxamide groupn-acylethanolaminecarboxylic acid derivativen-acyl-aminesecondary carboxylic acid amideorganic oxideorganic oxygen compoundorganopnictogen compoundhydrocarbon derivativeorganooxygen compound |
|---|