| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:56:25 UTC |
|---|
| Update Date | 2025-03-25 00:52:20 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02193022 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C17H22O5 |
|---|
| Molecular Mass | 306.1467 |
|---|
| SMILES | CCCC(O)CCC(=O)COC(=O)C=Cc1ccc(O)cc1 |
|---|
| InChI Key | BJULDDYCCJXERE-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | phenylpropanoids and polyketides |
|---|
| Class | cinnamic acids and derivatives |
|---|
| Subclass | hydroxycinnamic acids and derivatives |
|---|
| Direct Parent | hydroxycinnamic acids |
|---|
| Geometric Descriptor | aromatic homomonocyclic compounds |
|---|
| Alternative Parents | 1-hydroxy-2-unsubstituted benzenoidsalpha-acyloxy ketonesbenzene and substituted derivativesenoate estersfatty acid estersfatty alcohol estershydrocarbon derivativesketonesmonocarboxylic acids and derivativesorganic oxidessecondary alcohols |
|---|
| Substituents | fatty acylmonocyclic benzene moietycarbonyl groupalpha-acyloxy ketone1-hydroxy-2-unsubstituted benzenoidcarboxylic acid derivativeketonealpha,beta-unsaturated carboxylic esterorganic oxideenoate esteralcoholfatty alcohol esterhydroxycinnamic acidaromatic homomonocyclic compoundfatty acid estermonocarboxylic acid or derivativesorganic oxygen compoundcarboxylic acid estersecondary alcoholphenolhydrocarbon derivativebenzenoidorganooxygen compound |
|---|
