| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:56:29 UTC |
|---|
| Update Date | 2025-03-25 00:52:21 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02193192 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C25H32O5 |
|---|
| Molecular Mass | 412.225 |
|---|
| SMILES | CCCCCC1c2cc3c(cc2C(c2cc(OC)c(OC)c(OC)c2)C1C)OCO3 |
|---|
| InChI Key | ZTUWCLASGVMSAK-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organoheterocyclic compounds |
|---|
| Class | benzodioxoles |
|---|
| Subclass | benzodioxoles |
|---|
| Direct Parent | benzodioxoles |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | acetalsalkyl aryl ethersanisoleshydrocarbon derivativesindanesmethoxybenzenesoxacyclic compoundsphenoxy compounds |
|---|
| Substituents | phenol ethermonocyclic benzene moietyetheralkyl aryl ethermethoxybenzeneoxacycleorganic oxygen compoundacetalaromatic heteropolycyclic compoundanisoleindanehydrocarbon derivativebenzenoidphenoxy compoundorganooxygen compoundbenzodioxole |
|---|