| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:56:31 UTC |
|---|
| Update Date | 2025-03-25 00:52:22 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02193255 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C15H28O8 |
|---|
| Molecular Mass | 336.1784 |
|---|
| SMILES | CCCCCC(O)CCC(=O)OC1C(CO)OC(O)C(O)C1O |
|---|
| InChI Key | MEHANGBFHWUTSY-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | lipids and lipid-like molecules |
|---|
| Class | saccharolipids |
|---|
| Subclass | saccharolipids |
|---|
| Direct Parent | saccharolipids |
|---|
| Geometric Descriptor | aliphatic heteromonocyclic compounds |
|---|
| Alternative Parents | alkyl glycosidescarbonyl compoundscarboxylic acid estersfatty acid estersfatty acyl glycosides of mono- and disaccharidesfatty alcoholshemiacetalshydrocarbon derivativesmonocarboxylic acids and derivativesmonosaccharidesorganic oxidesoxacyclic compoundsoxanesprimary alcoholssecondary alcohols |
|---|
| Substituents | fatty acylfatty acyl glycoside of mono- or disaccharidecarbonyl groupmonosaccharidecarboxylic acid derivativesaccharideorganic oxidefatty alcoholaliphatic heteromonocyclic compoundhemiacetaloxaneprimary alcoholorganoheterocyclic compoundalcoholfatty acyl glycosideoxacyclefatty acid estermonocarboxylic acid or derivativesorganic oxygen compoundcarboxylic acid estersecondary alcoholhydrocarbon derivativesaccharolipidorganooxygen compoundalkyl glycoside |
|---|
