| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:56:32 UTC |
|---|
| Update Date | 2025-03-25 00:52:22 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02193325 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C13H26NO+ |
|---|
| Molecular Mass | 212.2009 |
|---|
| SMILES | CCCCCC=CC(O)=C(C)[N+](C)(C)C |
|---|
| InChI Key | PRLYNAFYYXZJRA-UHFFFAOYSA-O |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic nitrogen compounds |
|---|
| Class | organonitrogen compounds |
|---|
| Subclass | quaternary ammonium salts |
|---|
| Direct Parent | quaternary ammonium salts |
|---|
| Geometric Descriptor | aliphatic acyclic compounds |
|---|
| Alternative Parents | amineshydrocarbon derivativesorganic cationsorganic saltsorganooxygen compoundsorganopnictogen compounds |
|---|
| Substituents | aliphatic acyclic compoundorganic oxygen compoundquaternary ammonium saltorganopnictogen compoundhydrocarbon derivativeorganic cationorganic saltamineorganooxygen compound |
|---|