| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:56:35 UTC |
|---|
| Update Date | 2025-03-25 00:52:23 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02193407 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C15H27NO6 |
|---|
| Molecular Mass | 317.1838 |
|---|
| SMILES | CCCCC=CC(O)C(C)=NC1OC(CO)C(O)C(O)C1O |
|---|
| InChI Key | DSYLFGQJMBPLRM-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic oxygen compounds |
|---|
| Class | organooxygen compounds |
|---|
| Subclass | carbohydrates and carbohydrate conjugates |
|---|
| Direct Parent | monosaccharides |
|---|
| Geometric Descriptor | aliphatic heteromonocyclic compounds |
|---|
| Alternative Parents | hydrocarbon derivativesorganopnictogen compoundsoxacyclic compoundsoxanesprimary alcoholspropargyl-type 1,3-dipolar organic compoundssecondary alcoholssecondary ketimines |
|---|
| Substituents | alcoholketimineiminemonosaccharideorganic 1,3-dipolar compoundpropargyl-type 1,3-dipolar organic compoundsecondary ketimineoxacyclealiphatic heteromonocyclic compoundorganonitrogen compoundsecondary alcoholorganopnictogen compoundhydrocarbon derivativeorganic nitrogen compoundoxaneprimary alcoholorganoheterocyclic compound |
|---|