| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:56:39 UTC |
|---|
| Update Date | 2025-03-25 00:52:24 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02193582 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C8H17N5O3 |
|---|
| Molecular Mass | 231.1331 |
|---|
| SMILES | CN(C(=N)N)C(N)NCCCC(=O)C(=O)O |
|---|
| InChI Key | BSIKDBOLOPSOGF-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic acids and derivatives |
|---|
| Class | keto acids and derivatives |
|---|
| Subclass | short-chain keto acids and derivatives |
|---|
| Direct Parent | short-chain keto acids and derivatives |
|---|
| Geometric Descriptor | aliphatic acyclic compounds |
|---|
| Alternative Parents | alpha-hydroxy ketonesalpha-keto acids and derivativesamino acidscarboximidamidescarboxylic acidsdialkylaminesguanidineshydrocarbon derivativesiminesmonoalkylaminesmonocarboxylic acids and derivativesorganic oxidesorganopnictogen compoundsortho amidesorthocarboxylic acid derivatives |
|---|
| Substituents | aliphatic acyclic compoundcarbonyl groupcarboxylic acidortho amideamino acid or derivativesamino acidguanidineimineshort-chain keto acidalpha-hydroxy ketonecarboxylic acid derivativeketoneorganic oxideorganonitrogen compoundalpha-keto acidorganopnictogen compoundorthocarboxylic acid derivativesecondary aliphatic aminecarboximidamidesecondary aminemonocarboxylic acid or derivativesorganic oxygen compoundhydrocarbon derivativeprimary aliphatic amineorganic nitrogen compoundorganooxygen compoundamine |
|---|
