| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:56:40 UTC |
|---|
| Update Date | 2025-03-25 00:52:25 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02193591 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C20H24N2O3 |
|---|
| Molecular Mass | 340.1787 |
|---|
| SMILES | CN(C)C1Cc2ccccc2CC1Oc1ccc(NC(=O)CO)cc1 |
|---|
| InChI Key | IYEJENNZTAXEMZ-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | benzenoids |
|---|
| Class | tetralins |
|---|
| Subclass | tetralins |
|---|
| Direct Parent | tetralins |
|---|
| Geometric Descriptor | aromatic homopolycyclic compounds |
|---|
| Alternative Parents | alcohols and polyolsalkyl aryl ethersamino acids and derivativesanilidescarbonyl compoundscarboxylic acids and derivativeshydrocarbon derivativesn-arylamidesorganic oxidesorganopnictogen compoundsphenol ethersphenoxy compoundssecondary carboxylic acid amidestrialkylamines |
|---|
| Substituents | tetralinphenol ethermonocyclic benzene moietycarbonyl groupetheramino acid or derivativesn-arylamidealkyl aryl ethercarboxylic acid derivativeorganic oxideorganonitrogen compoundorganopnictogen compoundtertiary aminealcoholtertiary aliphatic aminearomatic homopolycyclic compoundcarboxamide groupanilidesecondary carboxylic acid amideorganic oxygen compoundhydrocarbon derivativeorganic nitrogen compoundphenoxy compoundamineorganooxygen compound |
|---|
