| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:56:40 UTC |
|---|
| Update Date | 2025-03-25 00:52:25 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02193598 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C14H20N2O2 |
|---|
| Molecular Mass | 248.1525 |
|---|
| SMILES | CN(C)CC(=O)N1CCCC1c1ccc(O)cc1 |
|---|
| InChI Key | GHVZDDLRFMYSQA-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organoheterocyclic compounds |
|---|
| Class | pyrrolidines |
|---|
| Subclass | phenylpyrrolidines |
|---|
| Direct Parent | phenylpyrrolidines |
|---|
| Geometric Descriptor | aromatic heteromonocyclic compounds |
|---|
| Alternative Parents | 1-hydroxy-2-unsubstituted benzenoidsalpha amino acidsazacyclic compoundsbenzene and substituted derivativescarbonyl compoundscarboxylic acids and derivativeshydrocarbon derivativesn-acylpyrrolidinesorganic oxidesorganopnictogen compoundspyrrolestertiary carboxylic acid amidestrialkylamines |
|---|
| Substituents | monocyclic benzene moietycarbonyl grouparomatic heteromonocyclic compoundamino acid or derivativesn-acylpyrrolidine1-hydroxy-2-unsubstituted benzenoidalpha-amino acid or derivativescarboxylic acid derivativeorganic oxidetertiary carboxylic acid amideorganonitrogen compoundalpha-amino acidorganopnictogen compoundtertiary amineazacycle2-phenylpyrrolidinetertiary aliphatic aminecarboxamide grouporganic oxygen compoundpyrrolephenolhydrocarbon derivativebenzenoidorganic nitrogen compoundamineorganooxygen compound |
|---|
