| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:56:42 UTC |
|---|
| Update Date | 2025-03-25 00:52:26 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02193700 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C17H24ClN5O3S2 |
|---|
| Molecular Mass | 445.1009 |
|---|
| SMILES | CN(C)Cc1ccc(CSCCNC(=NS(N)(=O)=O)Nc2ccc(Cl)cc2)o1 |
|---|
| InChI Key | ZGCHQCMDFOWJQL-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | benzenoids |
|---|
| Class | benzene and substituted derivatives |
|---|
| Subclass | halobenzenes |
|---|
| Direct Parent | chlorobenzenes |
|---|
| Geometric Descriptor | aromatic heteromonocyclic compounds |
|---|
| Alternative Parents | aralkylaminesaryl chloridesdialkylthioethersfuransguanidinesheteroaromatic compoundshydrocarbon derivativesorganic oxidesorganic sulfuric acids and derivativesorganochloridesorganooxygen compoundsorganopnictogen compoundsoxacyclic compoundssulfenyl compoundstrialkylamines |
|---|
| Substituents | furanaromatic heteromonocyclic compoundguanidineorganochlorideorganosulfur compoundorganohalogen compoundaralkylamineorganic oxideorganonitrogen compoundorganopnictogen compoundtertiary amineorganoheterocyclic compoundaryl chloridechlorobenzeneorganic sulfuric acid or derivativessulfenyl compounddialkylthioetherheteroaromatic compoundtertiary aliphatic aminearyl halideoxacycleorganic oxygen compoundthioetherhydrocarbon derivativeorganic nitrogen compoundamineorganooxygen compound |
|---|
