| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:56:43 UTC |
|---|
| Update Date | 2025-03-25 00:52:26 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02193712 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C13H22N2O2 |
|---|
| Molecular Mass | 238.1681 |
|---|
| SMILES | CN(C)CCOc1ccc(CC(N)CO)cc1 |
|---|
| InChI Key | WDANDMSRIATMKA-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | benzenoids |
|---|
| Class | benzene and substituted derivatives |
|---|
| Subclass | phenethylamines |
|---|
| Direct Parent | amphetamines and derivatives |
|---|
| Geometric Descriptor | aromatic homomonocyclic compounds |
|---|
| Alternative Parents | alkyl aryl ethershydrocarbon derivativesmonoalkylaminesorganopnictogen compoundsphenol ethersphenoxy compoundsprimary alcoholstrialkylamines |
|---|
| Substituents | alcoholphenol etherethertertiary aliphatic aminealkyl aryl etheraromatic homomonocyclic compoundorganic oxygen compoundorganonitrogen compoundorganopnictogen compoundhydrocarbon derivativeprimary aliphatic amineorganic nitrogen compoundphenoxy compoundprimary alcoholaminetertiary amineorganooxygen compoundamphetamine or derivatives |
|---|
