| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:56:43 UTC |
|---|
| Update Date | 2025-03-25 00:52:26 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02193734 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C18H19Cl2N |
|---|
| Molecular Mass | 319.0895 |
|---|
| SMILES | CN(C)CC1c2ccccc2CCc2cc(Cl)c(Cl)cc21 |
|---|
| InChI Key | RKAKBONVHVHLPG-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | benzenoids |
|---|
| Class | dibenzocycloheptenes |
|---|
| Subclass | dibenzocycloheptenes |
|---|
| Direct Parent | dibenzocycloheptenes |
|---|
| Geometric Descriptor | aromatic homopolycyclic compounds |
|---|
| Alternative Parents | aryl chlorideshydrocarbon derivativesorganochloridesorganopnictogen compoundstrialkylamines |
|---|
| Substituents | aryl chlorideorganochloridetertiary aliphatic aminearomatic homopolycyclic compoundorganohalogen compounddibenzocycloheptenearyl halideorganonitrogen compoundorganopnictogen compoundhydrocarbon derivativeorganic nitrogen compoundaminetertiary amine |
|---|