| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:56:46 UTC |
|---|
| Update Date | 2025-03-25 00:52:27 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02193815 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C11H16NO4PS |
|---|
| Molecular Mass | 289.0538 |
|---|
| SMILES | CCOP(=S)(OCC)Oc1ccccc1NC=O |
|---|
| InChI Key | VZKCQKSCFQVCQV-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic acids and derivatives |
|---|
| Class | organic thiophosphoric acids and derivatives |
|---|
| Subclass | thiophosphoric acid esters |
|---|
| Direct Parent | phenyl thiophosphates |
|---|
| Geometric Descriptor | aromatic homomonocyclic compounds |
|---|
| Alternative Parents | anilidescarbonyl compoundscarboxylic acids and derivativeshydrocarbon derivativesn-arylamidesorganic oxidesorganopnictogen compoundsphenoxy compoundssecondary carboxylic acid amidesthiophosphate triesters |
|---|
| Substituents | monocyclic benzene moietycarbonyl groupn-arylamidephenyl thiophosphatecarboxamide groupcarboxylic acid derivativearomatic homomonocyclic compoundanilidesecondary carboxylic acid amideorganic oxideorganic oxygen compoundorganonitrogen compoundorganopnictogen compoundhydrocarbon derivativebenzenoidthiophosphate triesterorganic nitrogen compoundphenoxy compoundorganooxygen compound |
|---|