| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:56:46 UTC |
|---|
| Update Date | 2025-03-25 00:52:27 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02193826 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C14H11Cl4O4P |
|---|
| Molecular Mass | 413.9149 |
|---|
| SMILES | CCOP(=O)(Oc1ccc(Cl)c(Cl)c1)Oc1ccc(Cl)cc1Cl |
|---|
| InChI Key | ICIARULTBMWQOZ-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic acids and derivatives |
|---|
| Class | organic phosphoric acids and derivatives |
|---|
| Subclass | phosphate esters |
|---|
| Direct Parent | aryl phosphotriesters |
|---|
| Geometric Descriptor | aromatic homomonocyclic compounds |
|---|
| Alternative Parents | aryl chloridesdichlorobenzeneshydrocarbon derivativesmonoalkyl phosphatesorganic oxidesorganochloridesorganooxygen compoundsphenoxy compounds |
|---|
| Substituents | aryl chloridechlorobenzenemonocyclic benzene moietyorganochlorideorganohalogen compoundaryl halide1,3-dichlorobenzenearomatic homomonocyclic compoundorganic oxideorganic oxygen compoundaryl phosphotriestermonoalkyl phosphatehydrocarbon derivative1,2-dichlorobenzenebenzenoidhalobenzenephenoxy compoundalkyl phosphateorganooxygen compound |
|---|
