| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:56:46 UTC |
|---|
| Update Date | 2025-03-25 00:52:27 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02193827 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C6H10Cl5O3PS |
|---|
| Molecular Mass | 367.8531 |
|---|
| SMILES | CCOP(=S)(OCC)OC(Cl)(Cl)C(Cl)(Cl)Cl |
|---|
| InChI Key | LGLYEQRVXCKAHB-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic acids and derivatives |
|---|
| Class | organic thiophosphoric acids and derivatives |
|---|
| Subclass | thiophosphoric acid esters |
|---|
| Direct Parent | thiophosphate triesters |
|---|
| Geometric Descriptor | aliphatic acyclic compounds |
|---|
| Alternative Parents | alkyl chlorideshydrocarbon derivativesorganochloridesorganooxygen compounds |
|---|
| Substituents | aliphatic acyclic compoundorganic oxygen compoundalkyl chlorideorganochloridealkyl halidehydrocarbon derivativethiophosphate triesterorganohalogen compoundorganooxygen compound |
|---|
