| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:56:48 UTC |
|---|
| Update Date | 2025-03-25 00:52:27 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02193890 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C13H18N2O2 |
|---|
| Molecular Mass | 234.1368 |
|---|
| SMILES | CCc1ccc(C(=O)CCCN(C)N=O)cc1 |
|---|
| InChI Key | FVABGVGJNUFGSY-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic oxygen compounds |
|---|
| Class | organooxygen compounds |
|---|
| Subclass | carbonyl compounds |
|---|
| Direct Parent | alkyl-phenylketones |
|---|
| Geometric Descriptor | aromatic homomonocyclic compounds |
|---|
| Alternative Parents | aryl alkyl ketonesbenzoyl derivativesbutyrophenoneshydrocarbon derivativesorganic n-nitroso compoundsorganic oxidesorganooxygen compoundsorganopnictogen compoundsphenylbutylamines |
|---|
| Substituents | monocyclic benzene moietyorganic nitroso compoundaryl alkyl ketonebenzoylbutyrophenonearomatic homomonocyclic compoundorganic n-nitroso compoundorganic oxidephenylbutylamineorganonitrogen compoundorganopnictogen compoundhydrocarbon derivativebenzenoidorganic nitrogen compoundalkyl-phenylketone |
|---|