| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:56:53 UTC |
|---|
| Update Date | 2025-03-25 00:52:29 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02194105 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C13H24N3O2S+ |
|---|
| Molecular Mass | 286.1584 |
|---|
| SMILES | CNC(=O)NCCSCc1ccc(C[N+](C)(C)C)o1 |
|---|
| InChI Key | DJWJGKMPGZQSIL-UHFFFAOYSA-O |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic nitrogen compounds |
|---|
| Class | organonitrogen compounds |
|---|
| Subclass | amines |
|---|
| Direct Parent | aralkylamines |
|---|
| Geometric Descriptor | aromatic heteromonocyclic compounds |
|---|
| Alternative Parents | carbonyl compoundsdialkylthioethersfuransheteroaromatic compoundshydrocarbon derivativesorganic carbonic acids and derivativesorganic cationsorganic oxidesorganic saltsorganopnictogen compoundsoxacyclic compoundssulfenyl compoundstetraalkylammonium salts |
|---|
| Substituents | furancarbonyl grouparomatic heteromonocyclic compoundorganosulfur compoundaralkylamineorganic oxideorganopnictogen compoundorganic cationorganic saltorganoheterocyclic compoundcarbonic acid derivativesulfenyl compoundtetraalkylammonium saltdialkylthioetherquaternary ammonium saltheteroaromatic compoundoxacycleorganic oxygen compoundthioetherhydrocarbon derivativeorganooxygen compound |
|---|