| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:56:54 UTC |
|---|
| Update Date | 2025-03-25 00:52:29 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02194116 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C10H12N2O3 |
|---|
| Molecular Mass | 208.0848 |
|---|
| SMILES | CNC(=O)c1cc(O)ccc1NC(C)=O |
|---|
| InChI Key | SJQFCFLHUPWKCQ-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | benzenoids |
|---|
| Class | benzene and substituted derivatives |
|---|
| Subclass | benzoic acids and derivatives |
|---|
| Direct Parent | acylaminobenzoic acid and derivatives |
|---|
| Geometric Descriptor | aromatic homomonocyclic compounds |
|---|
| Alternative Parents | 1-hydroxy-2-unsubstituted benzenoidsacetamidesacetanilidesbenzamidesbenzoyl derivativescarbonyl compoundscarboxylic acids and derivativeshydrocarbon derivativesn-acetylarylaminesorganic oxidesorganopnictogen compoundssecondary carboxylic acid amidesvinylogous amides |
|---|
| Substituents | carbonyl groupn-acetylarylaminebenzoyl1-hydroxy-2-unsubstituted benzenoidn-arylamidecarboxylic acid derivativebenzamideorganic oxideorganonitrogen compoundorganopnictogen compoundacetamidevinylogous amideacylaminobenzoic acid or derivativesacetanilidecarboxamide grouparomatic homomonocyclic compoundanilidesecondary carboxylic acid amideorganic oxygen compoundphenolhydrocarbon derivativeorganic nitrogen compoundorganooxygen compound |
|---|