| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:56:54 UTC |
|---|
| Update Date | 2025-03-25 00:52:30 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02194137 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C12H25N5O2 |
|---|
| Molecular Mass | 271.2008 |
|---|
| SMILES | CN=C(NC)NCCCC(=O)C(=O)NCCCCN |
|---|
| InChI Key | PLMOPQZCGMWMEU-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | lipids and lipid-like molecules |
|---|
| Class | fatty acyls |
|---|
| Subclass | fatty amides |
|---|
| Direct Parent | n-acyl amines |
|---|
| Geometric Descriptor | aliphatic acyclic compounds |
|---|
| Alternative Parents | carboximidamidescarboxylic acids and derivativesguanidineshydrocarbon derivativesiminesketonesmonoalkylaminesorganic oxidesorganopnictogen compoundspropargyl-type 1,3-dipolar organic compoundssecondary carboxylic acid amides |
|---|
| Substituents | aliphatic acyclic compoundcarbonyl groupguanidineimineorganic 1,3-dipolar compoundcarboximidamidecarboxamide groupcarboxylic acid derivativen-acyl-aminepropargyl-type 1,3-dipolar organic compoundketonesecondary carboxylic acid amideorganic oxideorganic oxygen compoundorganonitrogen compoundorganopnictogen compoundhydrocarbon derivativeprimary aliphatic amineorganic nitrogen compoundorganooxygen compound |
|---|