| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:56:56 UTC |
|---|
| Update Date | 2025-03-25 00:52:30 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02194186 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C18H20N2O4 |
|---|
| Molecular Mass | 328.1423 |
|---|
| SMILES | CN(CCCC(c1ccc(O)cc1)c1ccc(C(=O)O)cc1)N=O |
|---|
| InChI Key | TWLCMQWRVRLJIU-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | benzenoids |
|---|
| Class | benzene and substituted derivatives |
|---|
| Subclass | diphenylmethanes |
|---|
| Direct Parent | diphenylmethanes |
|---|
| Geometric Descriptor | aromatic homomonocyclic compounds |
|---|
| Alternative Parents | 1-hydroxy-2-unsubstituted benzenoidsaromatic monoterpenoidsbenzoic acidsbenzoyl derivativescarboxylic acidshydrocarbon derivativesmonocarboxylic acids and derivativesmonocyclic monoterpenoidsorganic n-nitroso compoundsorganic oxidesorganooxygen compoundsorganopnictogen compoundsphenylbutylamines |
|---|
| Substituents | diphenylmethanemonoterpenoidmonocyclic monoterpenoidcarboxylic acidbenzoyl1-hydroxy-2-unsubstituted benzenoidp-cymenecarboxylic acid derivativeorganic n-nitroso compoundorganic oxidephenylbutylamineorganonitrogen compoundorganopnictogen compoundbenzoic acidorganic nitroso compoundbenzoic acid or derivativesaromatic homomonocyclic compoundmonocarboxylic acid or derivativesorganic oxygen compoundphenolhydrocarbon derivativeorganic nitrogen compoundorganooxygen compoundaromatic monoterpenoid |
|---|
