| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:56:56 UTC |
|---|
| Update Date | 2025-03-25 00:52:30 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02194217 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C12H18N2O2S |
|---|
| Molecular Mass | 254.1089 |
|---|
| SMILES | CN(C)c1ccc(S(=O)(=O)N2CCCC2)cc1 |
|---|
| InChI Key | QWZBRYIVZDTKNZ-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | benzenoids |
|---|
| Class | benzene and substituted derivatives |
|---|
| Subclass | benzenesulfonamides |
|---|
| Direct Parent | aminobenzenesulfonamides |
|---|
| Geometric Descriptor | aromatic heteromonocyclic compounds |
|---|
| Alternative Parents | aniline and substituted anilinesazacyclic compoundsbenzenesulfonyl compoundsdialkylarylamineshydrocarbon derivativesorganic oxidesorganopnictogen compoundsorganosulfonamidespyrrolidinessulfonyls |
|---|
| Substituents | organosulfonic acid or derivativesaminobenzenesulfonamidearomatic heteromonocyclic compoundorganosulfur compoundorganosulfonic acid amideorganic oxidetertiary aliphatic/aromatic amineorganonitrogen compoundorganopnictogen compounddialkylarylaminepyrrolidinetertiary amineorganoheterocyclic compoundbenzenesulfonyl groupazacycleaniline or substituted anilinessulfonylorganic oxygen compoundorganic sulfonic acid or derivativeshydrocarbon derivativeorganic nitrogen compoundamine |
|---|
