| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:56:57 UTC |
|---|
| Update Date | 2025-03-25 00:52:30 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02194222 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C11H14N2O2 |
|---|
| Molecular Mass | 206.1055 |
|---|
| SMILES | CN(C)c1ccc(C(=O)CC(N)=O)cc1 |
|---|
| InChI Key | CHZAKBAZUXPUPV-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic oxygen compounds |
|---|
| Class | organooxygen compounds |
|---|
| Subclass | carbonyl compounds |
|---|
| Direct Parent | alkyl-phenylketones |
|---|
| Geometric Descriptor | aromatic homomonocyclic compounds |
|---|
| Alternative Parents | amino acids and derivativesaniline and substituted anilinesaryl alkyl ketonesbenzoyl derivativescarboxylic acids and derivativesdialkylarylaminesfatty amideshydrocarbon derivativesorganic oxidesorganopnictogen compoundsprimary carboxylic acid amides |
|---|
| Substituents | primary carboxylic acid amidefatty acylmonocyclic benzene moietyaryl alkyl ketoneamino acid or derivativesfatty amidebenzoylcarboxylic acid derivativeorganic oxidetertiary aliphatic/aromatic amineorganonitrogen compoundorganopnictogen compounddialkylarylaminetertiary amineaniline or substituted anilinescarboxamide grouparomatic homomonocyclic compoundhydrocarbon derivativebenzenoidorganic nitrogen compoundaminealkyl-phenylketone |
|---|