| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:56:57 UTC |
|---|
| Update Date | 2025-03-25 00:52:30 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02194234 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C7H12N6O2 |
|---|
| Molecular Mass | 212.1022 |
|---|
| SMILES | CN(C)c1nc(=O)c(NC(N)=O)c(N)[nH]1 |
|---|
| InChI Key | XSPQDPKAXKXBGK-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic nitrogen compounds |
|---|
| Class | organonitrogen compounds |
|---|
| Subclass | amines |
|---|
| Direct Parent | dialkylarylamines |
|---|
| Geometric Descriptor | aromatic heteromonocyclic compounds |
|---|
| Alternative Parents | aminopyrimidines and derivativesazacyclic compoundscarbonyl compoundsheteroaromatic compoundshydrocarbon derivativesorganic carbonic acids and derivativesorganic oxidesorganopnictogen compoundsprimary aminespyrimidonesvinylogous amides |
|---|
| Substituents | vinylogous amidecarbonyl groupcarbonic acid derivativearomatic heteromonocyclic compoundazacycleheteroaromatic compoundpyrimidonepyrimidineaminopyrimidineorganic oxideorganic oxygen compoundorganopnictogen compoundhydrocarbon derivativeprimary aminedialkylarylamineorganoheterocyclic compoundorganooxygen compound |
|---|
