| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:56:58 UTC |
|---|
| Update Date | 2025-03-25 00:52:31 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02194276 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C11H12N2O2 |
|---|
| Molecular Mass | 204.0899 |
|---|
| SMILES | CN1CC(=O)NC(=O)C1c1ccccc1 |
|---|
| InChI Key | HNOGMCRJLAKKAM-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organoheterocyclic compounds |
|---|
| Class | diazinanes |
|---|
| Subclass | piperazines |
|---|
| Direct Parent | phenylpiperazines |
|---|
| Geometric Descriptor | aromatic heteromonocyclic compounds |
|---|
| Alternative Parents | alpha amino acidsaralkylaminesazacyclic compoundsbenzene and substituted derivativescarbonyl compoundscarboxylic acids and derivativesdicarboximidesdioxopiperazineshydrocarbon derivativesn-methylpiperazinesn-unsubstituted carboxylic acid imidesorganic oxidesorganopnictogen compoundstrialkylamines |
|---|
| Substituents | monocyclic benzene moietycarbonyl grouparomatic heteromonocyclic compoundamino acid or derivativesalpha-amino acid or derivativescarboxylic acid derivativearalkylaminecarboxylic acid imide, n-unsubstitutedorganic oxidedioxopiperazineorganonitrogen compoundalpha-amino acidorganopnictogen compounddicarboximidetertiary amineazacyclen-alkylpiperazinetertiary aliphatic aminen-methylpiperazinephenylpiperazinecarboxylic acid imideorganic oxygen compoundhydrocarbon derivativebenzenoidorganic nitrogen compoundamineorganooxygen compound |
|---|
