| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:56:59 UTC |
|---|
| Update Date | 2025-03-25 00:52:31 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02194316 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C13H14F3NO3 |
|---|
| Molecular Mass | 289.0926 |
|---|
| SMILES | CN1C(=O)CC(O)(C(F)(F)F)CC1c1ccc(O)cc1 |
|---|
| InChI Key | SSNQULNFYKUGJW-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organoheterocyclic compounds |
|---|
| Class | piperidines |
|---|
| Subclass | phenylpiperidines |
|---|
| Direct Parent | phenylpiperidines |
|---|
| Geometric Descriptor | aromatic heteromonocyclic compounds |
|---|
| Alternative Parents | 1-hydroxy-2-unsubstituted benzenoidsalkyl fluoridesazacyclic compoundsbenzene and substituted derivativescarbonyl compoundscarboxylic acids and derivativesdelta lactamsfluorohydrinshydrocarbon derivativesorganic oxidesorganofluoridesorganonitrogen compoundsorganopnictogen compoundspiperidinonestertiary alcoholstertiary carboxylic acid amides |
|---|
| Substituents | monocyclic benzene moietycarbonyl grouplactamaromatic heteromonocyclic compound1-hydroxy-2-unsubstituted benzenoidfluorohydrincarboxylic acid derivativeorganohalogen compoundorganic oxidetertiary carboxylic acid amideorganonitrogen compoundorganopnictogen compoundalkyl halidepiperidinonealcoholazacyclehalohydrinalkyl fluorideorganofluoridecarboxamide groupdelta-lactamtertiary alcoholorganic oxygen compoundphenylpiperidinephenolhydrocarbon derivativebenzenoidorganic nitrogen compoundorganooxygen compound |
|---|
