| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:57:03 UTC |
|---|
| Update Date | 2025-03-25 00:52:33 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02194454 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C18H29N4S+ |
|---|
| Molecular Mass | 333.2107 |
|---|
| SMILES | CCCCCCCCCc1c[n+](Cc2cnc(C)nc2N)cs1 |
|---|
| InChI Key | GPSHTCCSMDMMBR-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organoheterocyclic compounds |
|---|
| Class | diazines |
|---|
| Subclass | pyrimidines and pyrimidine derivatives |
|---|
| Direct Parent | pyrimidines and pyrimidine derivatives |
|---|
| Geometric Descriptor | aromatic heteromonocyclic compounds |
|---|
| Alternative Parents | azacyclic compoundsheteroaromatic compoundshydrocarbon derivativesimidolactamsorganic cationsorganopnictogen compoundsprimary aminesthiazoles |
|---|
| Substituents | aromatic heteromonocyclic compoundazacycleheteroaromatic compoundpyrimidineorganonitrogen compoundorganopnictogen compoundhydrocarbon derivativeprimary amineorganic nitrogen compoundorganic cationimidolactamthiazoleamineazole |
|---|
