| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:57:03 UTC |
|---|
| Update Date | 2025-03-25 00:52:33 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02194466 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C15H25N3O3S |
|---|
| Molecular Mass | 327.1617 |
|---|
| SMILES | CCCCCCCCNC(=O)NS(=O)(=O)c1ccc(N)cc1 |
|---|
| InChI Key | NOWAHMQKXUHVJT-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | benzenoids |
|---|
| Class | benzene and substituted derivatives |
|---|
| Subclass | benzenesulfonamides |
|---|
| Direct Parent | benzenesulfonamides |
|---|
| Geometric Descriptor | aromatic homomonocyclic compounds |
|---|
| Alternative Parents | aminosulfonyl compoundsbenzenesulfonyl compoundscarbonyl compoundshydrocarbon derivativesorganic carbonic acids and derivativesorganic oxidesorganopnictogen compoundsorganosulfonic acids and derivativesprimary aminessulfonylureas |
|---|
| Substituents | organosulfonic acid or derivativescarbonyl groupcarbonic acid derivativebenzenesulfonamideaminosulfonyl compoundorganosulfur compoundaromatic homomonocyclic compoundorganic oxidesulfonylorganic oxygen compoundorganic sulfonic acid or derivativessulfonylureaorganonitrogen compoundorganopnictogen compoundhydrocarbon derivativeprimary amineorganic nitrogen compoundamineorganooxygen compoundbenzenesulfonyl group |
|---|
