| Record Information | 
|---|
| HMDB Status | Not Available | 
|---|
| Creation Date | 2024-02-21 14:57:03 UTC | 
|---|
| Update Date | 2025-03-25 00:52:32 UTC | 
|---|
| HMDB ID | Not Available | 
|---|
| Metabolite Identification | 
|---|
| DeepMet ID | DMID02194467 | 
|---|
| Frequency | 0.5 | 
|---|
| Structure |  | 
|---|
| Chemical Formula | C15H22O3S | 
|---|
| Molecular Mass | 282.129 | 
|---|
| SMILES | CCCCCCCc1scc(CCC(=O)O)c1C=O | 
|---|
| InChI Key | HSRBKVZKLXIFHA-UHFFFAOYSA-N | 
|---|
| Chemical Taxonomy | 
|---|
| Kingdom | organic compounds | 
|---|
| Superclass | organoheterocyclic compounds | 
|---|
| Class | thiophenes | 
|---|
| Subclass | thiophene carboxylic acids and derivatives | 
|---|
| Direct Parent | thiophene carboxylic acids and derivatives | 
|---|
| Geometric Descriptor | aromatic heteromonocyclic compounds | 
|---|
| Alternative Parents | aryl-aldehydescarboxylic acidsheteroaromatic compoundshydrocarbon derivativesmonocarboxylic acids and derivativesorganic oxides | 
|---|
| Substituents | carbonyl groupcarboxylic acidaromatic heteromonocyclic compoundheteroaromatic compoundaldehydecarboxylic acid derivativethiophene carboxylic acid or derivativesorganic oxidemonocarboxylic acid or derivativesaryl-aldehydeorganic oxygen compoundhydrocarbon derivativeorganooxygen compound | 
|---|