| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:57:10 UTC |
|---|
| Update Date | 2025-03-25 00:52:34 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02194713 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C17H19NO |
|---|
| Molecular Mass | 253.1467 |
|---|
| SMILES | CCN(CC)c1ccc(C(=O)c2ccccc2)cc1 |
|---|
| InChI Key | IDLJKTNBZKSHIY-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | benzenoids |
|---|
| Class | benzene and substituted derivatives |
|---|
| Subclass | benzophenones |
|---|
| Direct Parent | benzophenones |
|---|
| Geometric Descriptor | aromatic homomonocyclic compounds |
|---|
| Alternative Parents | aniline and substituted anilinesaryl ketonesaryl-phenylketonesbenzoyl derivativesdialkylarylaminesdiphenylmethaneshydrocarbon derivativesorganic oxidesorganooxygen compoundsorganopnictogen compounds |
|---|
| Substituents | diphenylmethaneaniline or substituted anilinesaryl-phenylketonebenzoylbenzophenoneketonearomatic homomonocyclic compoundorganic oxideorganic oxygen compoundtertiary aliphatic/aromatic amineorganonitrogen compoundorganopnictogen compoundhydrocarbon derivativeorganic nitrogen compounddialkylarylamineaminetertiary amineorganooxygen compoundaryl ketone |
|---|
