| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:57:10 UTC |
|---|
| Update Date | 2025-03-25 00:52:35 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02194714 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C11H17N3O3S |
|---|
| Molecular Mass | 271.0991 |
|---|
| SMILES | CCN(CC)S(=O)(=O)c1ccc(N)c(C(N)=O)c1 |
|---|
| InChI Key | OODHRXJBYYIDIW-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | benzenoids |
|---|
| Class | benzene and substituted derivatives |
|---|
| Subclass | benzenesulfonamides |
|---|
| Direct Parent | benzenesulfonamides |
|---|
| Geometric Descriptor | aromatic homomonocyclic compounds |
|---|
| Alternative Parents | amino acids and derivativesaminosulfonyl compoundsbenzamidesbenzenesulfonyl compoundsbenzoyl derivativescarboxylic acids and derivativeshydrocarbon derivativesorganic oxidesorganooxygen compoundsorganopnictogen compoundsorganosulfonamidesprimary aminesprimary carboxylic acid amidesvinylogous amides |
|---|
| Substituents | primary carboxylic acid amideorganosulfonic acid or derivativesamino acid or derivativesbenzoylorganosulfur compoundcarboxylic acid derivativebenzamideorganosulfonic acid amideorganic oxideorganonitrogen compoundorganopnictogen compoundbenzenesulfonyl groupvinylogous amidebenzenesulfonamideaminosulfonyl compoundbenzoic acid or derivativescarboxamide grouparomatic homomonocyclic compoundsulfonylorganic oxygen compoundorganic sulfonic acid or derivativeshydrocarbon derivativeprimary amineorganic nitrogen compoundamineorganooxygen compound |
|---|
