| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:57:10 UTC |
|---|
| Update Date | 2025-03-25 00:52:35 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02194718 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C9H10F9NO3S |
|---|
| Molecular Mass | 383.0238 |
|---|
| SMILES | CCN(CC)S(=O)(=O)C(=O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
|---|
| InChI Key | QTAQVMKVJKAGDX-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic acids and derivatives |
|---|
| Class | organic sulfonic acids and derivatives |
|---|
| Subclass | organosulfonic acids and derivatives |
|---|
| Direct Parent | acylsulfonic acids and derivatives |
|---|
| Geometric Descriptor | aliphatic acyclic compounds |
|---|
| Alternative Parents | alkyl fluoridesaminosulfonyl compoundscarbonyl compoundscarboxylic acids and derivativeshydrocarbon derivativesorganic oxidesorganic sulfonamidesorganofluoridesorganonitrogen compoundsorganopnictogen compoundsorganosulfonamidesthiolactones |
|---|
| Substituents | aliphatic acyclic compoundcarbonyl groupaminosulfonyl compoundalkyl fluorideorganofluorideacylsulfonic acid or derivativesorganosulfur compoundcarboxylic acid derivativeorganohalogen compoundorganosulfonic acid amideorganic oxidesulfonylorganic oxygen compoundorganonitrogen compoundorganopnictogen compoundalkyl halidehydrocarbon derivativeorganic nitrogen compoundorganic sulfonic acid amidethiolactoneorganooxygen compound |
|---|
