| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:57:11 UTC |
|---|
| Update Date | 2025-03-25 00:52:35 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02194761 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C17H24N4O |
|---|
| Molecular Mass | 300.195 |
|---|
| SMILES | CCN1CCN(C(=O)C(N)Cc2c[nH]c3ccccc23)CC1 |
|---|
| InChI Key | XSJIHIXQOJSXDL-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic acids and derivatives |
|---|
| Class | carboxylic acids and derivatives |
|---|
| Subclass | amino acids, peptides, and analogues |
|---|
| Direct Parent | alpha amino acid amides |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | alpha amino acidsazacyclic compoundsbenzenoidscarbonyl compoundscarboxylic acids and derivativesheteroaromatic compoundshydrocarbon derivativesindolesmonoalkylaminesn-alkylpiperazinesorganic oxidesorganopnictogen compoundspyrrolestertiary carboxylic acid amidestrialkylamines |
|---|
| Substituents | carbonyl groupindoleorganic oxidepiperazinearomatic heteropolycyclic compoundtertiary carboxylic acid amideorganonitrogen compoundalpha-amino acidorganopnictogen compoundtertiary amineorganoheterocyclic compoundalpha-amino acid amideazacyclen-alkylpiperazineheteroaromatic compoundtertiary aliphatic amineindole or derivativescarboxamide grouporganic oxygen compound1,4-diazinanepyrrolehydrocarbon derivativebenzenoidprimary aliphatic amineorganic nitrogen compoundamineorganooxygen compound |
|---|
