| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:57:12 UTC |
|---|
| Update Date | 2025-03-25 00:52:36 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02194806 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C16H19NO2 |
|---|
| Molecular Mass | 257.1416 |
|---|
| SMILES | CCN(CC)CC(=O)Oc1cccc2ccccc12 |
|---|
| InChI Key | CYKXQLWIBLKJIK-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic acids and derivatives |
|---|
| Class | carboxylic acids and derivatives |
|---|
| Subclass | amino acids, peptides, and analogues |
|---|
| Direct Parent | alpha amino acid esters |
|---|
| Geometric Descriptor | aromatic homopolycyclic compounds |
|---|
| Alternative Parents | alpha amino acidscarbonyl compoundscarboxylic acid estershydrocarbon derivativesmonocarboxylic acids and derivativesnaphthalenesorganic oxidesorganopnictogen compoundstrialkylamines |
|---|
| Substituents | carbonyl groupalpha-amino acid estertertiary aliphatic aminearomatic homopolycyclic compoundorganic oxidemonocarboxylic acid or derivativesnaphthaleneorganic oxygen compoundcarboxylic acid esterorganonitrogen compoundalpha-amino acidorganopnictogen compoundhydrocarbon derivativebenzenoidorganic nitrogen compoundaminetertiary amineorganooxygen compound |
|---|