| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:57:14 UTC |
|---|
| Update Date | 2025-03-25 00:52:36 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02194850 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C18H30O9 |
|---|
| Molecular Mass | 390.189 |
|---|
| SMILES | CCOC(=O)C(O)C(OC(C)=O)C(OC(=O)C(C)C)C(OC(C)=O)C(C)C |
|---|
| InChI Key | DRCOZBKDIJUDHC-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic acids and derivatives |
|---|
| Class | carboxylic acids and derivatives |
|---|
| Subclass | tetracarboxylic acids and derivatives |
|---|
| Direct Parent | tetracarboxylic acids and derivatives |
|---|
| Geometric Descriptor | aliphatic acyclic compounds |
|---|
| Alternative Parents | carbonyl compoundscarboxylic acid estersfatty acid estersfatty alcoholshydrocarbon derivativesmonosaccharidesorganic oxidessecondary alcohols |
|---|
| Substituents | alcoholfatty acylaliphatic acyclic compoundcarbonyl groupmonosaccharidetetracarboxylic acid or derivativesfatty acid estersaccharideorganic oxideorganic oxygen compoundfatty alcoholcarboxylic acid estersecondary alcoholhydrocarbon derivativeorganooxygen compound |
|---|
