| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:57:14 UTC |
|---|
| Update Date | 2025-03-25 00:52:36 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02194861 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C14H20N2O2 |
|---|
| Molecular Mass | 248.1525 |
|---|
| SMILES | CCOC(=O)N1CCC(N)(c2ccccc2)CC1 |
|---|
| InChI Key | BJOMZIWEYLNBGF-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organoheterocyclic compounds |
|---|
| Class | piperidines |
|---|
| Subclass | phenylpiperidines |
|---|
| Direct Parent | phenylpiperidines |
|---|
| Geometric Descriptor | aromatic heteromonocyclic compounds |
|---|
| Alternative Parents | azacyclic compoundsbenzene and substituted derivativescarbamate esterscarbonyl compoundshydrocarbon derivativesmonoalkylaminesorganic carbonic acids and derivativesorganic oxidesorganonitrogen compoundsorganopnictogen compoundspiperidinecarboxylic acids |
|---|
| Substituents | monocyclic benzene moietycarbonyl groupcarbonic acid derivativearomatic heteromonocyclic compoundazacyclecarbamic acid esterorganic oxideorganic oxygen compoundphenylpiperidineorganonitrogen compoundorganopnictogen compoundhydrocarbon derivativepiperidinecarboxylic acidbenzenoidprimary aliphatic amineorganic nitrogen compoundorganooxygen compound |
|---|