| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:57:16 UTC |
|---|
| Update Date | 2025-03-25 00:52:37 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02194924 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C13H12O4 |
|---|
| Molecular Mass | 232.0736 |
|---|
| SMILES | CCOC(=O)C(=O)C(=O)C=Cc1ccccc1 |
|---|
| InChI Key | DZGMSFVREYVDFL-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | phenylpropanoids and polyketides |
|---|
| Class | cinnamic acids and derivatives |
|---|
| Subclass | cinnamic acids and derivatives |
|---|
| Direct Parent | cinnamic acids and derivatives |
|---|
| Geometric Descriptor | aromatic homomonocyclic compounds |
|---|
| Alternative Parents | acryloyl compoundsalpha-diketonesalpha-keto acids and derivativesbenzene and substituted derivativesbeta-keto acids and derivativescarboxylic acid estersenonesfatty acid estershydrocarbon derivativesmonocarboxylic acids and derivativesorganic oxides |
|---|
| Substituents | fatty acylmonocyclic benzene moietycarbonyl groupalpha,beta-unsaturated ketonecarboxylic acid derivativealpha-diketonebeta-keto acidketonearomatic homomonocyclic compoundfatty acid estercinnamic acid or derivativesorganic oxidemonocarboxylic acid or derivativesorganic oxygen compoundketo acidcarboxylic acid esteralpha-keto acidhydrocarbon derivativebenzenoidacryloyl-grouporganooxygen compoundenone |
|---|
