| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:57:20 UTC |
|---|
| Update Date | 2025-03-25 00:52:39 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02195095 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C8H12N6S |
|---|
| Molecular Mass | 224.0844 |
|---|
| SMILES | CCCSc1nc(N)c2[nH]c(N)nc2n1 |
|---|
| InChI Key | GYXLKZNDNKGMPH-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organoheterocyclic compounds |
|---|
| Class | imidazopyrimidines |
|---|
| Subclass | purines and purine derivatives |
|---|
| Direct Parent | purines and purine derivatives |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | alkylarylthioethersazacyclic compoundsheteroaromatic compoundshydrocarbon derivativesimidazolesimidolactamsorganopnictogen compoundsprimary aminespyrimidines and pyrimidine derivativessulfenyl compounds |
|---|
| Substituents | sulfenyl compoundazacycleheteroaromatic compoundalkylarylthioetherorganosulfur compoundaryl thioetherpyrimidinearomatic heteropolycyclic compoundthioetherimidazoleorganonitrogen compoundorganopnictogen compoundhydrocarbon derivativeprimary aminepurineorganic nitrogen compoundimidolactamamineazole |
|---|
