| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:57:24 UTC |
|---|
| Update Date | 2025-03-25 00:52:40 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02195237 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C12H22N2O2 |
|---|
| Molecular Mass | 226.1681 |
|---|
| SMILES | CC1CCC2(CCN(C(=O)C(C)N)CC2)O1 |
|---|
| InChI Key | LIKRTDBEKCNRFC-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic acids and derivatives |
|---|
| Class | carboxylic acids and derivatives |
|---|
| Subclass | amino acids, peptides, and analogues |
|---|
| Direct Parent | alpha amino acid amides |
|---|
| Geometric Descriptor | aliphatic heteromonocyclic compounds |
|---|
| Alternative Parents | alpha amino acidsazacyclic compoundsazaspirodecane derivativescarbonyl compoundscarboxylic acids and derivativesdialkyl ethershydrocarbon derivativesmonoalkylaminesn-acylpiperidinesorganic oxidesorganonitrogen compoundsorganopnictogen compoundsoxacyclic compoundstertiary carboxylic acid amidestetrahydrofurans |
|---|
| Substituents | carbonyl groupetherdialkyl etherorganic oxidetertiary carboxylic acid amidealiphatic heteromonocyclic compoundorganonitrogen compoundalpha-amino acidorganopnictogen compoundpiperidineorganoheterocyclic compoundalpha-amino acid amideazacycletetrahydrofurancarboxamide groupazaspirodecaneoxacyclen-acyl-piperidineorganic oxygen compoundhydrocarbon derivativeprimary aliphatic amineorganic nitrogen compoundorganooxygen compound |
|---|
