| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:57:24 UTC |
|---|
| Update Date | 2025-03-25 00:52:40 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02195268 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C15H20O3 |
|---|
| Molecular Mass | 248.1412 |
|---|
| SMILES | CC1CCC(C)(C(=O)OCc2ccccc2)OC1 |
|---|
| InChI Key | OLWHUPNLIFJTSY-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | benzenoids |
|---|
| Class | benzene and substituted derivatives |
|---|
| Subclass | benzyloxycarbonyls |
|---|
| Direct Parent | benzyloxycarbonyls |
|---|
| Geometric Descriptor | aromatic heteromonocyclic compounds |
|---|
| Alternative Parents | carbonyl compoundscarboxylic acid estersdialkyl ethershydrocarbon derivativesmonocarboxylic acids and derivativesorganic oxidesoxacyclic compoundsoxanespyran carboxylic acids |
|---|
| Substituents | benzyloxycarbonylcarbonyl groupetherpyran carboxylic acid or derivativesaromatic heteromonocyclic compoundcarboxylic acid derivativepyran carboxylic aciddialkyl etheroxacycleorganic oxidemonocarboxylic acid or derivativesorganic oxygen compoundpyrancarboxylic acid esterhydrocarbon derivativeoxaneorganoheterocyclic compoundorganooxygen compound |
|---|
