| Record Information | 
|---|
| HMDB Status | Not Available | 
|---|
| Creation Date | 2024-02-21 14:57:28 UTC | 
|---|
| Update Date | 2025-03-25 00:52:41 UTC | 
|---|
| HMDB ID | Not Available | 
|---|
| Metabolite Identification | 
|---|
| DeepMet ID | DMID02195399 | 
|---|
| Frequency | 0.5 | 
|---|
| Structure |  | 
|---|
| Chemical Formula | C20H24O7 | 
|---|
| Molecular Mass | 376.1522 | 
|---|
| SMILES | CC1C(Oc2cccc(CC3CC(=O)OC3=O)c2)OC(C(=O)O)C(C)C1C | 
|---|
| InChI Key | BWMXPKXMFIVDGF-UHFFFAOYSA-N | 
|---|
| Chemical Taxonomy | 
|---|
| Kingdom | organic compounds | 
|---|
| Superclass | organoheterocyclic compounds | 
|---|
| Class | pyrans | 
|---|
| Subclass  | pyran carboxylic acids and derivatives | 
|---|
| Direct Parent  | pyran carboxylic acids | 
|---|
| Geometric Descriptor  | aromatic heteromonocyclic compounds | 
|---|
| Alternative Parents  | acetalscarbonyl compoundscarboxylic acid anhydridescarboxylic acidshydrocarbon derivativeslactonesorganic oxidesoxacyclic compoundsoxanesphenol ethersphenoxy compoundstetrahydrofuranstricarboxylic acids and derivatives | 
|---|
| Substituents  | phenol ethermonocyclic benzene moietycarbonyl groupcarboxylic acidpyran carboxylic acid or derivativesaromatic heteromonocyclic compoundtetrahydrofurantricarboxylic acid or derivativescarboxylic acid derivativelactoneoxacycleorganic oxideorganic oxygen compoundacetalcarboxylic acid anhydridehydrocarbon derivativebenzenoidphenoxy compoundoxaneorganooxygen compound | 
|---|