| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:57:28 UTC |
|---|
| Update Date | 2025-03-25 00:52:41 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02195403 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C23H36O10 |
|---|
| Molecular Mass | 472.2308 |
|---|
| SMILES | CC1C(Oc2ccc(CCOC3OC(CO)C(O)C(O)C3O)cc2)OC(C(O)O)C(C)C1C |
|---|
| InChI Key | DWAVUILJRKTNMH-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | benzenoids |
|---|
| Class | phenols |
|---|
| Subclass | tyrosols and derivatives |
|---|
| Direct Parent | tyrosols and derivatives |
|---|
| Geometric Descriptor | aromatic heteromonocyclic compounds |
|---|
| Alternative Parents | acetalscarbonyl hydrateshydrocarbon derivativesmonosaccharidesoxacyclic compoundsoxanesphenol ethersphenoxy compoundsprimary alcoholssecondary alcohols |
|---|
| Substituents | alcoholphenol ethermonocyclic benzene moietycarbonyl hydratearomatic heteromonocyclic compoundmonosaccharideoxacyclesaccharideorganic oxygen compoundacetalsecondary alcoholhydrocarbon derivativetyrosol derivativephenoxy compoundoxaneprimary alcoholorganoheterocyclic compoundorganooxygen compound |
|---|
