| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:57:28 UTC |
|---|
| Update Date | 2025-03-25 00:52:41 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02195404 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C19H24O5 |
|---|
| Molecular Mass | 332.1624 |
|---|
| SMILES | CC1C(Oc2ccc3ccc(O)cc3c2)OC(C(O)O)C(C)C1C |
|---|
| InChI Key | IDOHCVNAAGKCTG-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | benzenoids |
|---|
| Class | naphthalenes |
|---|
| Subclass | naphthols and derivatives |
|---|
| Direct Parent | naphthols and derivatives |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | 1-hydroxy-2-unsubstituted benzenoidsacetalscarbonyl hydrateshydrocarbon derivativesorganooxygen compoundsoxacyclic compoundsoxanesphenol ethers |
|---|
| Substituents | phenol ethercarbonyl hydrate1-hydroxy-2-unsubstituted benzenoidoxacycleorganic oxygen compoundacetalaromatic heteropolycyclic compoundhydrocarbon derivativeoxane2-naphtholorganoheterocyclic compoundorganooxygen compound |
|---|
