| Record Information | 
|---|
| HMDB Status | Not Available | 
|---|
| Creation Date | 2024-02-21 14:57:29 UTC | 
|---|
| Update Date | 2025-03-25 00:52:41 UTC | 
|---|
| HMDB ID | Not Available | 
|---|
| Metabolite Identification | 
|---|
| DeepMet ID | DMID02195439 | 
|---|
| Frequency | 0.5 | 
|---|
| Structure |  | 
|---|
| Chemical Formula | C11H20N3O13P3 | 
|---|
| Molecular Mass | 495.0209 | 
|---|
| SMILES | CC1C(COP(=O)(O)OP(=O)(O)OP(=O)(O)O)C(CO)OC1n1ccc(N)nc1=O | 
|---|
| InChI Key | ZZUOTTZQOOALPB-UHFFFAOYSA-N | 
|---|
| Chemical Taxonomy | 
|---|
| Kingdom | organic compounds | 
|---|
| Superclass | organoheterocyclic compounds | 
|---|
| Class | diazines | 
|---|
| Subclass  | pyrimidines and pyrimidine derivatives | 
|---|
| Direct Parent  | pyrimidones | 
|---|
| Geometric Descriptor  | aromatic heteromonocyclic compounds | 
|---|
| Alternative Parents  | azacyclic compoundsheteroaromatic compoundshydrocarbon derivativesimidolactamsmonoalkyl phosphatesorganic carbonic acids and derivativesorganic oxidesorganopnictogen compoundsoxacyclic compoundsprimary alcoholsprimary aminestetrahydrofurans | 
|---|
| Substituents  | aromatic heteromonocyclic compoundpyrimidoneorganic oxideorganonitrogen compoundorganopnictogen compoundprimary alcoholimidolactamalcoholcarbonic acid derivativeazacycletetrahydrofuranheteroaromatic compoundoxacycleorganic oxygen compoundphosphoric acid estermonoalkyl phosphatehydrocarbon derivativeprimary amineorganic nitrogen compoundorganic phosphoric acid derivativeaminealkyl phosphateorganooxygen compound | 
|---|