| Record Information | 
|---|
| HMDB Status | Not Available | 
|---|
| Creation Date | 2024-02-21 14:57:29 UTC | 
|---|
| Update Date | 2025-03-25 00:52:42 UTC | 
|---|
| HMDB ID | Not Available | 
|---|
| Metabolite Identification | 
|---|
| DeepMet ID | DMID02195443 | 
|---|
| Frequency | 0.5 | 
|---|
| Structure |  | 
|---|
| Chemical Formula | C14H24O12 | 
|---|
| Molecular Mass | 384.1268 | 
|---|
| SMILES | CC1C(OCOC(C(O)CO)C(O)C(O)C=O)OC(C(=O)O)C(O)C1O | 
|---|
| InChI Key | QPUDLTGJQXQAHD-UHFFFAOYSA-N | 
|---|
| Chemical Taxonomy | 
|---|
| Kingdom | organic compounds | 
|---|
| Superclass | lipids and lipid-like molecules | 
|---|
| Class | saccharolipids | 
|---|
| Subclass  | saccharolipids | 
|---|
| Direct Parent  | saccharolipids | 
|---|
| Geometric Descriptor  | aliphatic heteromonocyclic compounds | 
|---|
| Alternative Parents  | acetalsalpha-hydroxyaldehydesbeta hydroxy acids and derivativesbeta-hydroxy aldehydescarboxylic acidsfatty alcoholshydrocarbon derivativesmonocarboxylic acids and derivativesmonosaccharidesorganic oxidesoxacyclic compoundsoxanesprimary alcoholspyran carboxylic acidssecondary alcohols | 
|---|
| Substituents  | fatty acylbeta-hydroxy aldehydecarbonyl groupcarboxylic acidmonosaccharidecarboxylic acid derivativepyran carboxylic acidbeta-hydroxy acidsaccharideorganic oxidealpha-hydroxyaldehydeacetalfatty alcoholaliphatic heteromonocyclic compoundoxaneprimary alcoholorganoheterocyclic compoundalcoholpyran carboxylic acid or derivativesaldehydehydroxy acidoxacyclemonocarboxylic acid or derivativesorganic oxygen compoundpyransecondary alcoholhydrocarbon derivativesaccharolipidorganooxygen compound | 
|---|