| Record Information | 
|---|
| HMDB Status | Not Available | 
|---|
| Creation Date | 2024-02-21 14:57:30 UTC | 
|---|
| Update Date | 2025-03-25 00:52:42 UTC | 
|---|
| HMDB ID | Not Available | 
|---|
| Metabolite Identification | 
|---|
| DeepMet ID | DMID02195479 | 
|---|
| Frequency | 0.5 | 
|---|
| Structure |  | 
|---|
| Chemical Formula | C29H44O20 | 
|---|
| Molecular Mass | 712.2426 | 
|---|
| SMILES | CC1OC(OCC2OC(OC(=O)CCC(O)Cc3cc(O)c(O)c(O)c3)C(O)C(O)C2OC2OC(CO)C(O)C(O)C2O)C(O)C(O)C1O | 
|---|
| InChI Key | PVVRDCPVFABHEP-UHFFFAOYSA-N | 
|---|
| Chemical Taxonomy | 
|---|
| Kingdom | organic compounds | 
|---|
| Superclass | lipids and lipid-like molecules | 
|---|
| Class | fatty acyls | 
|---|
| Subclass  | fatty acyl glycosides | 
|---|
| Direct Parent  | fatty acyl glycosides of mono- and disaccharides | 
|---|
| Geometric Descriptor  | aromatic heteromonocyclic compounds | 
|---|
| Alternative Parents  | 1-hydroxy-2-unsubstituted benzenoids1-hydroxy-4-unsubstituted benzenoidsacetalsbenzene and substituted derivativescarbonyl compoundscarboxylic acid estersfatty acid estershydrocarbon derivativesmonocarboxylic acids and derivativesmonosaccharidesorganic oxidesoxacyclic compoundsoxanesprimary alcoholspyrogallols and derivativessecondary alcohols | 
|---|
| Substituents  | fatty acyl glycoside of mono- or disaccharidemonocyclic benzene moietycarbonyl grouparomatic heteromonocyclic compound1-hydroxy-2-unsubstituted benzenoidmonosaccharidecarboxylic acid derivativesaccharideorganic oxideacetaloxaneprimary alcoholorganoheterocyclic compoundalcoholpyrogallol derivativebenzenetriol1-hydroxy-4-unsubstituted benzenoidoxacyclefatty acid estermonocarboxylic acid or derivativesorganic oxygen compoundcarboxylic acid estersecondary alcoholphenolhydrocarbon derivativebenzenoidorganooxygen compound | 
|---|