| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:57:30 UTC |
|---|
| Update Date | 2025-03-25 00:52:42 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02195483 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C20H20O6 |
|---|
| Molecular Mass | 356.126 |
|---|
| SMILES | CC1OC(Oc2ccc3c(c2)cc(O)c2ccccc23)C(O)C(O)C1O |
|---|
| InChI Key | JIMQLJXDSHXWPL-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | benzenoids |
|---|
| Class | phenanthrenes and derivatives |
|---|
| Subclass | phenanthrols |
|---|
| Direct Parent | phenanthrols |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | 1-hydroxy-2-unsubstituted benzenoidsacetalshydrocarbon derivativesmonosaccharidesnaphthols and derivativesoxacyclic compoundsoxanesphenol etherssecondary alcohols |
|---|
| Substituents | alcoholphenol etherphenanthrol1-hydroxy-2-unsubstituted benzenoidmonosaccharideoxacyclesaccharidenaphthaleneorganic oxygen compoundacetalaromatic heteropolycyclic compoundsecondary alcoholhydrocarbon derivative1-naphtholoxane2-naphtholorganoheterocyclic compoundorganooxygen compound |
|---|