| Record Information | 
|---|
| HMDB Status | Not Available | 
|---|
| Creation Date | 2024-02-21 14:57:30 UTC | 
|---|
| Update Date | 2025-03-25 00:52:42 UTC | 
|---|
| HMDB ID | Not Available | 
|---|
| Metabolite Identification | 
|---|
| DeepMet ID | DMID02195496 | 
|---|
| Frequency | 0.5 | 
|---|
| Structure |  | 
|---|
| Chemical Formula | C17H22O7 | 
|---|
| Molecular Mass | 338.1366 | 
|---|
| SMILES | CC1OC(c2cc(CC3CCC(=O)O3)ccc2O)C(O)C(O)C1O | 
|---|
| InChI Key | VAGCFGHMSJOMRX-UHFFFAOYSA-N | 
|---|
| Chemical Taxonomy | 
|---|
| Kingdom | organic compounds | 
|---|
| Superclass | benzenoids | 
|---|
| Class | phenols | 
|---|
| Subclass  | 1-hydroxy-2-unsubstituted benzenoids | 
|---|
| Direct Parent  | 1-hydroxy-2-unsubstituted benzenoids | 
|---|
| Geometric Descriptor  | aromatic heteromonocyclic compounds | 
|---|
| Alternative Parents  | benzene and substituted derivativescarbonyl compoundscarboxylic acid estersdialkyl ethersgamma butyrolactoneshydrocarbon derivativesmonocarboxylic acids and derivativesmonosaccharidesorganic oxidesoxacyclic compoundsoxanessecondary alcoholstetrahydrofurans | 
|---|
| Substituents  | monocyclic benzene moietycarbonyl groupetheraromatic heteromonocyclic compound1-hydroxy-2-unsubstituted benzenoidmonosaccharidecarboxylic acid derivativedialkyl etherlactonesaccharideorganic oxideoxaneorganoheterocyclic compoundalcoholtetrahydrofurangamma butyrolactoneoxacyclemonocarboxylic acid or derivativesorganic oxygen compoundcarboxylic acid estersecondary alcoholhydrocarbon derivativeorganooxygen compound | 
|---|