| Record Information | 
|---|
| HMDB Status | Not Available | 
|---|
| Creation Date | 2024-02-21 14:57:31 UTC | 
|---|
| Update Date | 2025-03-25 00:52:42 UTC | 
|---|
| HMDB ID | Not Available | 
|---|
| Metabolite Identification | 
|---|
| DeepMet ID | DMID02195514 | 
|---|
| Frequency | 0.5 | 
|---|
| Structure |  | 
|---|
| Chemical Formula | C19H32O16 | 
|---|
| Molecular Mass | 516.169 | 
|---|
| SMILES | CC1OC(OC2C(OC3C(C(=O)O)OC(O)C(O)C3O)OC(CO)C(CO)C2O)C(O)C(O)C1O | 
|---|
| InChI Key | HGBRMRKELOMNIG-UHFFFAOYSA-N | 
|---|
| Chemical Taxonomy | 
|---|
| Kingdom | organic compounds | 
|---|
| Superclass | organic oxygen compounds | 
|---|
| Class | organooxygen compounds | 
|---|
| Subclass  | carbohydrates and carbohydrate conjugates | 
|---|
| Direct Parent  | glucuronic acid derivatives | 
|---|
| Geometric Descriptor  | aliphatic heteromonocyclic compounds | 
|---|
| Alternative Parents  | acetalscarbonyl compoundscarboxylic acidshemiacetalshydrocarbon derivativesmonocarboxylic acids and derivativesmonosaccharidesorganic oxidesoxacyclic compoundsoxanesprimary alcoholspyran carboxylic acidssecondary alcohols | 
|---|
| Substituents  | alcoholcarbonyl groupcarboxylic acidpyran carboxylic acid or derivativesglucuronic acid or derivativesmonosaccharidecarboxylic acid derivativepyran carboxylic acidoxacycleorganic oxidemonocarboxylic acid or derivativesacetalpyranaliphatic heteromonocyclic compoundsecondary alcoholhemiacetalhydrocarbon derivativeoxaneprimary alcoholorganoheterocyclic compound | 
|---|