| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:57:34 UTC |
|---|
| Update Date | 2025-03-25 00:52:43 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02195628 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C12H22O3 |
|---|
| Molecular Mass | 214.1569 |
|---|
| SMILES | CC=C(C)C(OC(=O)C(C)C)C(C)(C)O |
|---|
| InChI Key | XOFJDIXPPWULST-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic oxygen compounds |
|---|
| Class | organooxygen compounds |
|---|
| Subclass | alcohols and polyols |
|---|
| Direct Parent | tertiary alcohols |
|---|
| Geometric Descriptor | aliphatic acyclic compounds |
|---|
| Alternative Parents | carbonyl compoundscarboxylic acid estershydrocarbon derivativesmonocarboxylic acids and derivativesorganic oxides |
|---|
| Substituents | aliphatic acyclic compoundcarbonyl grouptertiary alcoholorganic oxidemonocarboxylic acid or derivativescarboxylic acid esterhydrocarbon derivativecarboxylic acid derivative |
|---|
